A7898512
1,2,4-Trifluorobenzene , >98.0%(GC) , 367-23-7
CAS NO.:367-23-7
Empirical Formula: C6H3F3
Molecular Weight: 132.08
MDL number: MFCD00000305
EINECS: 206-684-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB116.00 | In Stock |
|
| 100G | RMB400.00 | In Stock |
|
| 500G | RMB1496.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 88 °C/759 mmHg (lit.) |
| Density | 1.264 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 40 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.264 |
| BRN | 2042865 |
| InChI | InChI=1S/C6H3F3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | PEBWOGPSYUIOBP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1F |
| CAS DataBase Reference | 367-23-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2,4-Trifluorobenzene(367-23-7) |
Description and Uses
1,2,4-Trifluorobenzene can be used as composite membranes with improved performance and durability.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36-7-33-29-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








