A7899212
Tetrabutyl Orthosilicate , >98.0%(GC) , 4766-57-8
Synonym(s):
Tetrabutoxysilane
CAS NO.:4766-57-8
Empirical Formula: C16H36O4Si
Molecular Weight: 320.54
MDL number: MFCD00009432
EINECS: 225-305-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB26.40 | In Stock |
|
| 25ML | RMB88.80 | In Stock |
|
| 100ML | RMB332.80 | In Stock |
|
| 500ML | RMB1468.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -80 °C |
| Boiling point: | 275 °C (lit.) |
| Density | 0.899 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Flash point: | 174 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| Specific Gravity | 0.9 |
| color | colorless |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1709274 |
| InChI | 1S/C16H36O4Si/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4/h5-16H2,1-4H3 |
| InChIKey | UQMOLLPKNHFRAC-UHFFFAOYSA-N |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)OCCCC |
| CAS DataBase Reference | 4766-57-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutyl silicate(4766-57-8) |
| EPA Substance Registry System | Silicic acid (H4SiO4), tetrabutyl ester (4766-57-8) |
Description and Uses
It is an important organic intermediate used in agrochemicals, pharmaceuticals and dyestuff fields and also in the alkylation and alkoxylation of silane.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280a-P321-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | UN2924 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29209090 |
| Storage Class | 10 - Combustible liquids |




