A7900812
Tetrahydropyran-4-carboxylic Acid , >98.0%(GC) , 5337-03-1
CAS NO.：5337-03-1
Empirical Formula: C6H10O3
Molecular Weight: 130.14
MDL number: MFCD00031016
EINECS: 633-404-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB46.40 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB476.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87 °C |
| Boiling point: | 114-146°C 11mm |
| Density | 1.1066 (rough estimate) |
| refractive index | 1.4315 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 4.43±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C6H10O3/c7-6(8)5-1-3-9-4-2-5/h5H,1-4H2,(H,7,8) |
| InChIKey | AVPKHOTUOHDTLW-UHFFFAOYSA-N |
| SMILES | C1OCCC(C(O)=O)C1 |
| CAS DataBase Reference | 5337-03-1(CAS DataBase Reference) |
Description and Uses
Tetrahydropyran-4-yl-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22-20/21/22 |
| Safety Statements | 26-36/37/39-22-39-24/25 |
| RIDADR | 2811 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
