A7901912
2,2,2-Trifluoroethyl <i>p</i>-Toluenesulfonate , >98.0%(GC) , 433-06-7
CAS NO.:433-06-7
Empirical Formula: C9H9F3O3S
Molecular Weight: 254.23
MDL number: MFCD00000443
EINECS: 207-085-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100g | RMB234.40 | In Stock |
|
| 500G | RMB993.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-38 °C(lit.) |
| Boiling point: | 87-92 °C0.1 mm Hg(lit.) |
| Density | 1 g/cm3 |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Solid |
| color | White to Off-White |
| Sensitive | Moisture Sensitive |
| BRN | 2699394 |
| Stability: | Hygroscopic |
| InChI | 1S/C9H9F3O3S/c1-7-2-4-8(5-3-7)16(13,14)15-6-9(10,11)12/h2-5H,6H2,1H3 |
| InChIKey | IGKCQDUYZULGBM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)OCC(F)(F)F |
| CAS DataBase Reference | 433-06-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanol, 2,2,2-trifluoro-, 4-methylbenzenesulfonate(433-06-7) |
| EPA Substance Registry System | Ethanol, 2,2,2-trifluoro-, 4-methylbenzenesulfonate (433-06-7) |
Description and Uses
2,2,2-Trifluoroethyl Tosylate is a trifluoroethylation agent used in the preparation of 2,2,2-trifluoroethyl phenyl sulfone, a potential 2,2,2-trifluoroethyl pronucleophile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







