A7906112
2,3,4-Trifluorobenzyl Bromide , >98.0%(GC) , 157911-55-2
CAS NO.:157911-55-2
Empirical Formula: C7H4BrF3
Molecular Weight: 225.01
MDL number: MFCD00061233
EINECS: 624-279-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB322.40 | In Stock |
|
| 5G | RMB1111.20 | In Stock |
|
| 25g | RMB4239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 191.4±35.0 °C(Predicted) |
| Density | 1.710 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Sensitive | Lachrymatory |
| BRN | 8762822 |
| InChI | InChI=1S/C7H4BrF3/c8-3-4-1-2-5(9)7(11)6(4)10/h1-2H,3H2 |
| InChIKey | DGSXDQVPGXFOAN-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 157911-55-2(CAS DataBase Reference) |
Description and Uses
2,3,4-Trifluorobenzyl bromide may be used to synthesize phase-transfer catalysts (PTCs).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H227-H318 |
| Precautionary statements | P210e-P260h-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | T |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





