A7907112
4-(Trifluoromethyl)styrene (stabilized with TBC) , >98.0%(GC) , 402-50-6
Synonym(s):
4-Vinylbenzotrifluoride
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB52.00 | In Stock |
|
| 1G | RMB179.20 | In Stock |
|
| 5G | RMB787.20 | In Stock |
|
| 10g | RMB1165.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65-66 °C40 mm Hg(lit.) |
| Density | 1.165 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 108 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| BRN | 1863548 |
| InChI | InChI=1S/C9H7F3/c1-2-7-3-5-8(6-4-7)9(10,11)12/h2-6H,1H2 |
| InChIKey | CEWDRCQPGANDRS-UHFFFAOYSA-N |
| SMILES | C1(C=C)=CC=C(C(F)(F)F)C=C1 |
Description and Uses
4-(Trifluoromethyl)styrene is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Light Sensitive/Irritant |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








