Tris(2,4-di-<i>tert</i>-butylphenyl) Phosphite , >98.0% , 31570-04-4
Synonym(s):
2,4-Bis(1,1-dimethylethyl)phenol phosphite (3:1);Tri(2,4-di-tert -butylphenyl) phosphite;Tri(2,4-di-t -butylphenyl) phosphite;Tris(2,4-di-tert-butylphenyl) phosphite
CAS NO.:31570-04-4
Empirical Formula: C42H63O3P
Molecular Weight: 646.94
MDL number: MFCD00072706
EINECS: 250-709-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB27.20 | In Stock |
|
| 10g | RMB55.20 | In Stock |
|
| 100G | RMB61.60 | In Stock |
|
| 500G | RMB280.00 | In Stock |
|
| 2.5KG | RMB856.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 181-184 °C(lit.) |
| Boiling point: | 594.2±50.0 °C(Predicted) |
| Density | -0.98 |
| Flash point: | 46°C (115°F) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Sparingly), Ethyl Acetate (Sparingly, Heate |
| form | Powder |
| Specific Gravity | 0.98 |
| color | white |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sensitive | moisture sensitive |
| Stability: | Moisture Sensitive |
| InChIKey | JKIJEFPNVSHHEI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OP(Oc2ccc(cc2C(C)(C)C)C(C)(C)C)Oc3ccc(cc3C(C)(C)C)C(C)(C)C)c(c1)C(C)(C)C |
| LogP | 18 at 25℃ |
| CAS DataBase Reference | 31570-04-4(CAS DataBase Reference) |
| EPA Substance Registry System | Tris(2,4-di-tert-butylphenyl) phosphite (31570-04-4) |
Description and Uses
ANTIOXIDANT 168 is a secondary antioxidant with excellent resistance to extraction by water, low volatility and high heat stability. It can effectively decompose hydroperoxides produced during the processing of polymeric materials. ANTIOXIDANT 168 usually not used alone, is compounded with hindered phenolic primary antioxidants such as 1010 to improve thermostability of polymer during the processing. There are over ten kinds of blends of 168 with phenolic antioxidants, widely use in the polymer materials such as PE, PP, PA, PC, ABS and so on.
Tris(2,4-tert-butylphenyl) Phosphite is an intermediate in the synthesis of Tris(2,4-di-tert-butylphenyl)phosphate (T884500), a processing stabilizer for polymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | - |
| TSCA | TSCA listed |
| HS Code | 2920900002 |
| Storage Class | 13 - Non Combustible Solids |



