A7918512
Tetramethylammonium Tetrafluoroborate , 98.0% , 661-36-9
CAS NO.：661-36-9
Empirical Formula: C4H12BF4N
Molecular Weight: 160.95
MDL number: MFCD00011745
EINECS: 211-547-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5g | RMB53.60 | In Stock |
|
| 25G | RMB222.40 | In Stock |
|
| 100g | RMB572.80 | In Stock |
|
| 500g | RMB2811.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| storage temp. | Store below +30°C. |
| form | crystal |
| color | white |
| Water Solubility | Solubility in hot water is almost transparent. |
| Sensitive | Hygroscopic |
| BRN | 3715404 |
| Stability: | hygroscopic |
| InChI | 1S/C4H12N.BF4/c1-5(2,3)4;2-1(3,4)5/h1-4H3;/q+1;-1 |
| InChIKey | XWFABLFRYCHILB-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.F[B-](F)(F)F |
| CAS DataBase Reference | 661-36-9(CAS DataBase Reference) |
Description and Uses
It is used in the catalytic reduction of 1,6-dihalohexanes by nickel(i) salen electrogenerated at glassy carbon cathodes in dimethylformamide.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BS8300000 |
| Hazard Note | Irritant/Hygroscopic |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
