A7920012
Tetrahexylammonium Iodide , >98.0%(T) , 2138-24-1
CAS NO.:2138-24-1
Empirical Formula: C24H52IN
Molecular Weight: 481.58
MDL number: MFCD00041981
EINECS: 218-382-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB71.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-101 °C |
| Density | 1.0444 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | almost transparency[in Methanol] |
| solubility | almost transparency in Methanol |
| form | Crystalline |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 4164997 |
| InChI | 1S/C24H52N.HI/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;/h5-24H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | VRKHAMWCGMJAMI-UHFFFAOYSA-M |
| SMILES | [I-].CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
| CAS DataBase Reference | 2138-24-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Hexanaminium, N,N,N-trihexyl-, iodide (2138-24-1) |
Description and Uses
Tetrahexylammonium iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




