A7926112
Tetraphenylgermane , 95% , 1048-05-1
Synonym(s):
Tetraphenyl germanium
CAS NO.：1048-05-1
Empirical Formula: C24H20Ge
Molecular Weight: 381.06
MDL number: MFCD00002997
EINECS: 213-880-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB83.20 | In Stock |
|
| 1G | RMB257.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-235 °C (lit.) |
| Boiling point: | >400°C |
| refractive index | 1.5800 |
| storage temp. | RT, protect from light, stored under nitrogen |
| form | solid |
| color | White to Almost white |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C24H20Ge/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | ILEXMONMGUVLRM-UHFFFAOYSA-N |
| SMILES | [Ge](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1048-05-1(CAS DataBase Reference) |
| EPA Substance Registry System | Germane, tetraphenyl- (1048-05-1) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-36 |
| WGK Germany | 2 |
| TSCA | Yes |
| HS Code | 2931.90.6000 |
