A7927912
2,2',4,4'-Tetrahydroxybenzophenone , >98.0%(HPLC) , 131-55-5
CAS NO.:131-55-5
Empirical Formula: C13H10O5
Molecular Weight: 246.22
MDL number: MFCD00002278
EINECS: 205-028-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB276.00 | In Stock |
|
| 500g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-200 °C(lit.) |
| Boiling point: | 349.21°C (rough estimate) |
| Density | 1.216 |
| refractive index | 1.4825 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| pka | 6.98±0.35(Predicted) |
| color | Needles from H2O |
| Water Solubility | Slightly soluble in water. |
| BRN | 1914746 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | FRAGRANCE UV ABSORBER LIGHT STABILIZER |
| Cosmetic Ingredient Review (CIR) | 2,2',4,4'-Tetrahydroxybenzophenone (131-55-5) |
| InChI | 1S/C13H10O5/c14-7-1-3-9(11(16)5-7)13(18)10-4-2-8(15)6-12(10)17/h1-6,14-17H |
| InChIKey | WXNRYSGJLQFHBR-UHFFFAOYSA-N |
| SMILES | Oc1ccc(c(O)c1)C(=O)c2ccc(O)cc2O |
| LogP | 3.091 (est) |
| CAS DataBase Reference | 131-55-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,2',4,4'-Tetrahydroxybenzophenone(131-55-5) |
| EPA Substance Registry System | 2,2',4,4'-Tetrahydroxybenzophenone (131-55-5) |
Description and Uses
2,2',4,4'-Tetrahydroxybenzophenone is a uV-absorber that helps protect against product degradation because of uV-light exposure. It can also mask odor associated with a formulation’s composition.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | DJ1892000 |
| TSCA | TSCA listed |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1A |
| Hazardous Substances Data | 131-55-5(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 1220mg/kg |






![(Butylamine)[2,2'-thiobis(4-tert-octylphenolato)]nickel(II)](https://img.chemicalbook.com/CAS/GIF/14516-71-3.gif)
