A7928612
<i>trans</i>-1-Methyl-4-carboxy-5-(3-pyridyl)-2-pyrrolidinone , >95.0%(HPLC)(T) , 33224-01-0
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB31.20 | In Stock |
|
| 100MG | RMB68.80 | In Stock |
|
| 1G | RMB314.40 | In Stock |
|
| 5G | RMB1106.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-195 °C(lit.) |
| Boiling point: | 483.8±45.0 °C(Predicted) |
| Density | 1.327±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 3.94±0.40(Predicted) |
| InChI | 1S/C11H12N2O3/c1-13-9(14)5-8(11(15)16)10(13)7-3-2-4-12-6-7/h2-4,6,8,10H,5H2,1H3,(H,15,16)/t8-,10+/m0/s1 |
| InChIKey | DEYLVDCFTICBTB-WCBMZHEXSA-N |
| SMILES | CN1[C@@H]([C@H](CC1=O)C(O)=O)c2cccnc2 |
| CAS DataBase Reference | 33224-01-0(CAS DataBase Reference) |
Description and Uses
trans-4-Cotininecarboxylic acid was used in the preparation of cotinine-conjugated horseradish peroxidase during immunoblot analysis. Anion of trans-4-cotininecarboxylic acid has been employed as pyridyl-carboxylate ligand in the preparation of polymeric copper(II) complex.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933.79.8500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


