A7935912
Tetrabromobisphenol A Bis(2-hydroxyethyl) Ether , >93.0% , 4162-45-2
Synonym(s):
2,2-Bis[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]propane;2,2-Bis[4-(2-hydroxyethoxy)-3,5-dibromophenyl]propane;Tetrabromobisphenol A bis(2-hydroxyethyl) ether
CAS NO.:4162-45-2
Empirical Formula: C19H20Br4O4
Molecular Weight: 631.98
MDL number: MFCD00059603
EINECS: 224-005-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 500g | RMB760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107 °C(lit.) |
| Boiling point: | 582.1±50.0 °C(Predicted) |
| Density | 1.8110 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.76±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C19H20Br4O4/c1-19(2,11-7-13(20)17(14(21)8-11)26-5-3-24)12-9-15(22)18(16(23)10-12)27-6-4-25/h7-10,24-25H,3-6H2,1-2H3 |
| InChIKey | RVHUMFJSCJBNGS-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(Br)c(OCCO)c(Br)c1)c2cc(Br)c(OCCO)c(Br)c2 |
| CAS DataBase Reference | 4162-45-2(CAS DataBase Reference) |
| EPA Substance Registry System | Tetrabromobisphenol A bis(2-hydroxyethyl) ether (4162-45-2) |
Description and Uses
4,4''-Isopropylidenebis[2-(2,6-dibromophenoxy)ethanol] is a brominated flame retardant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3152 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | II |
| HS Code | 29094990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





