A7936312
Tetraethylene Glycol Diacrylate (stabilized with MEHQ) , >90.0%(GC) , 17831-71-9
Synonym(s):
TTEGDA
CAS NO.：17831-71-9
Empirical Formula: C14H22O7
Molecular Weight: 302.32
MDL number: MFCD00081876
EINECS: 241-789-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB47.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100g | RMB383.20 | In Stock |
|
| 500g | RMB768.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12-17 °C |
| Boiling point: | 363.35°C (rough estimate) |
| Density | 1.11 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | n |
| Flash point: | 347 °F |
| solubility | H2O: soluble |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | 95.6g/L at 20℃ |
| α-end | acrylate |
| Ω-end | acrylate |
| Cosmetics Ingredients Functions | PLASTICISER |
| InChI | 1S/C14H22O7/c1-3-13(15)20-11-9-18-7-5-17-6-8-19-10-12-21-14(16)4-2/h3-4H,1-2,5-12H2 |
| InChIKey | HCLJOFJIQIJXHS-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOCCOC(=O)C=C |
| LogP | 0.814 at 40℃ |
| CAS DataBase Reference | 17831-71-9 |
| EPA Substance Registry System | Tetraethylene glycol diacrylate (17831-71-9) |
Description and Uses
Tetra(ethylene glycol) diacrylate is a long-chain hydrophilic, crosslinking monomer widely used in the preparation of gel polymer electrolytes for Li-ion polymer batteries, acrylic polymers, and coating materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 41-34-22 |
| Safety Statements | 26-36/37/39-45-28-27 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 2 |
| RTECS | AS8100000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
