A7965412
2,4,5-Trifluoro-3-hydroxybenzoic Acid , >98.0% , 116751-24-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| 500g | RMB7839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-147 °C(lit.) |
| Boiling point: | 292.6±40.0 °C(Predicted) |
| Density | 1.699±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.75±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H3F3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13) |
| InChIKey | YYAFUGSJSHXYNK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C(O)=C1F |
| CAS DataBase Reference | 116751-24-7(CAS DataBase Reference) |
Description and Uses
3-Hydroxy-2,4,5-trifluorobenzoic acid may be used to synthesize methyl 3-methoxy-2,4,5-trifluorobenzoate and ethyl 3-ethoxy-2,4,5-trifluorobenzoate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




