A7965712
2,4,5-Trifluorobenzoic Acid , ≥97% , 446-17-3
CAS NO.:446-17-3
Empirical Formula: C7H3F3O2
Molecular Weight: 176.09
MDL number: MFCD00013306
EINECS: 610-198-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB60.80 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB438.40 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 241.9±35.0 °C(Predicted) |
| Density | 1.4362 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| pka | 2.87±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| BRN | 3257609 |
| InChI | InChI=1S/C7H3F3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12) |
| InChIKey | AKAMNXFLKYKFOJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 446-17-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,4,5-trifluoro- (446-17-3) |
Description and Uses
2,4,5-Trifluorobenzoic Acid is a useful synthetic intermediate. It can be used to synthesize quinolone antibacterial agnts.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |





