A7969712
1-(<i>tert</i>-Butyldimethylsilyl)imidazole [<i>tert</i>-Butyldimethylsilylating Agent] , >95% , 54925-64-3
Synonym(s):
TBDMSIM
CAS NO.:54925-64-3
Empirical Formula: C9H18N2Si
Molecular Weight: 182.34
MDL number: MFCD00011682
EINECS: 259-398-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB214.40 | In Stock |
|
| 5G | RMB855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 53 °C0.2 mm Hg(lit.) |
| Density | 0.939 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 211 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 7.63±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 0.939 |
| color | Colorless to Almost colorless |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 606695 |
| InChI | 1S/C9H18N2Si/c1-9(2,3)12(4,5)11-7-6-10-8-11/h6-8H,1-5H3 |
| InChIKey | VUENSYJCBOSTCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)n1ccnc1 |
| CAS DataBase Reference | 54925-64-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-(Tert-butyldimethylsilyl)imidazole(54925-64-3) |
Description and Uses
1-(tert-Butyldimethylsilyl)imidazole is used as a doping agent in europium-doped luminescent ionogel.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-34-20/21/22-10-61-20/21 |
| Safety Statements | 26-36-45-36/37/39-16-53 |
| RIDADR | UN 2922 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![1-(<i>tert</i>-Butyldimethylsilyl)imidazole [<i>tert</i>-Butyldimethylsilylating Agent]](https://img.chemicalbook.com/CAS/GIF/54925-64-3.gif)





