A7971112
1-Trifluoromethyl-3,3-dimethyl-1,2-benziodoxole , >97.0%(HPLC) , 887144-97-0
Synonym(s):
1,3-Dihydro-3,3-dimethyl-1-(trifluoromethyl)-1,2-benziodoxole;Togni’s Reagent
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB64.00 | In Stock |
|
| 1G | RMB196.80 | In Stock |
|
| 5G | RMB756.80 | In Stock |
|
| 10g | RMB1399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-79 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| color | white to off-white |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C10H10F3IO/c1-9(2)7-5-3-4-6-8(7)14(15-9)10(11,12)13/h3-6H,1-2H3 |
| InChIKey | HVAPLSNCVYXFDQ-UHFFFAOYSA-N |
| SMILES | I1(C(F)(F)F)C2=CC=CC=C2C(C)(C)O1 |
Description and Uses
Togni’s Reagent is used in trifluoromethylation reactions.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.1 |
| PackingGroup | Ⅲ |
| HS Code | 29349990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |




