A7972012
Tetrazolium Violet , >98.0% , 1719-71-7
Synonym(s):
2,5-Diphenyl-3-(α-naphthyl)tetrazolium chloride;2,5-Diphenyl-3-(1-naphthyl)tetrazolium chloride;TV
CAS NO.：1719-71-7
Empirical Formula: C23H17ClN4
Molecular Weight: 384.86
MDL number: MFCD00011875
EINECS: 217-008-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB222.40 | In Stock |
|
| 5G | RMB927.20 | In Stock |
|
| 10G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-250 °C (dec.) |
| Boiling point: | 539.8°C (rough estimate) |
| Density | 1.1386 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | Flammables area |
| solubility | Soluble in water, ethanol, methanol |
| form | powder |
| color | Yellow brown or tan |
| λmax | 244 nm |
| Biological Applications | Analysis of microorganisms; detecting anti-bacterial agent,γ-hydroxybutyric acid (GHB); treating cancer,pain |
| InChI | InChI=1S/C23H17N4.ClH/c1-3-11-19(12-4-1)23-24-26(20-14-5-2-6-15-20)27(25-23)22-17-9-13-18-10-7-8-16-21(18)22;/h1-17H;1H/q+1;/p-1 |
| InChIKey | RONADMZTCCPLEF-UHFFFAOYSA-M |
| SMILES | [N+]1(=NC(C2=CC=CC=C2)=NN1C1C=CC=CC=1)C1C=CC=C2C=CC=CC=12.[Cl-] |
| CAS DataBase Reference | 1719-71-7(CAS DataBase Reference) |
Description and Uses
Tetrazolium Violet has been used to stain agar layers in bacteriophage plaque formation assays.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi-F |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 37/39-26-16-24/25 |
| WGK Germany | 3 |
| RTECS | XF8080000 |
| F | 3-8-10 |
| HS Code | 32129000 |
