A7974112
<i>trans</i>,<i>cis</i>-2,6-Nonadienal , >95.0%(GC) , 557-48-2
Synonym(s):
(E,Z)-2,6-Nonadienal;Violet leaf aldehyde
CAS NO.:557-48-2
Empirical Formula: C9H14O
Molecular Weight: 138.21
MDL number: MFCD00007009
EINECS: 209-178-6
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB47.20 | In Stock |
|
| 1G | RMB141.60 | In Stock |
|
| 5G | RMB495.20 | In Stock |
|
| 25g | RMB1771.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 94-95 °C18 mm Hg(lit.) |
| Density | 0.86 g/mL at 25 °C(lit.) |
| refractive index | n |
| FEMA | 3377 | NONA-2-TRANS-6-CIS-DIENAL |
| Flash point: | 181 °F |
| storage temp. | Refrigerator |
| solubility | Soluble in ethanol and most non volatile oils, insoluble in water. |
| form | Oil |
| color | Sltly yellow liquid |
| Odor | powerful, violet-cucumber odor |
| Odor Type | green |
| biological source | synthetic |
| Sensitive | Air Sensitive |
| JECFA Number | 1186 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING FLAVOURING FRAGRANCE |
| InChI | 1S/C9H14O/c1-2-3-4-5-6-7-8-9-10/h3-4,7-9H,2,5-6H2,1H3/b4-3-,8-7+ |
| InChIKey | HZYHMHHBBBSGHB-ODYTWBPASA-N |
| SMILES | [H]C(=O)C(\[H])=C(/[H])CC\C([H])=C(\[H])CC |
| LogP | 2.60 |
| CAS DataBase Reference | 557-48-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2,6-Nonadienal, (2E,6Z)- (557-48-2) |
Description and Uses
trans-2,cis-6-Nonadienal is an unsaturated aldehyde that is responsible for the cucumber smell of Synura petersenii, a freshwater colonial flagellate. trans-2,cis-6-Nonadienal is also a common natural and drinking water contaminant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 2 |
| RTECS | RA5391800 |
| TSCA | TSCA listed |
| HS Code | 2912.19.5000 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LD50 orl-rat: >5 g/kg FCTOD7 20,769,82 |





