Home Categories Organic Chemistry [5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II)
A7979312

[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) , >96.0% , 28903-71-1

CAS NO.:28903-71-1

Empirical Formula: C48H36CoN4O4

Molecular Weight: 791.77

MDL number: MFCD00010724

EINECS: 677-580-2

Pack Size Price Stock Quantity
250MG RMB150.40 In Stock
1G RMB455.20 In Stock
5G RMB1255.20 In Stock
others     Enquire
Update time: 2022-07-08

PRODUCT Properties

Melting point: 241-248°C
storage temp.  Sealed in dry,Room Temperature
form  Crystals or Powder
color  Purple to violet
Appearance Purple to blue-purple crystals or powder
λmax 417 nm
530 nm (2nd)
InChIKey QBCIMRXPMLWVML-NHZJRHMYSA-N
SMILES O(C1C=CC(C2=C3C=CC4C(C5C=CC(OC)=CC=5)=C5C=CC6=C(C7C=CC(OC)=CC=7)C7C=CC8=C(C9C=CC(OC)=CC=9)C9=CC=C2[N-]9[Co+2](N=78)([N-]56)N3=4)=CC=1)C

Description and Uses

[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) is a versatile metalloporphyrin compound with significant potential in various applications. It is widely used in photodynamic therapy (PDT) for cancer treatment, where it can absorb light and produce reactive oxygen species to target and destroy cancer cells. Additionally, it plays a crucial role in the development of solar cells, enhancing the efficiency of light absorption and energy conversion in photovoltaic devices. The compound also serves as a catalyst in various chemical reactions, particularly in organic synthesis, improving reaction rates and selectivity compared to traditional catalysts. Furthermore, it is employed in the creation of sensors for detecting environmental pollutants, leveraging its ability to interact with specific molecules for accurate measurements. Its unique porphyrin structure makes it valuable in academic research for studying the properties of metal-organic frameworks and their potential applications in drug delivery and materials science.

Starting material in the synthesis of cobalt nitrosyl porphyrins for use in the study of the binding and activation of nitric oxide.

Safety

Symbol(GHS) 
GHS07
Signal word  Warning
Hazard statements  H302
Precautionary statements  P280-P305+P351+P338
PPE Eyeshields, Gloves, type N95 (US)
Safety Statements  24/25
WGK Germany  3
HS Code  29339900
Storage Class 11 - Combustible Solids

RELATED PRODUCTS