[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) , >96.0% , 28903-71-1
CAS NO.:28903-71-1
Empirical Formula: C48H36CoN4O4
Molecular Weight: 791.77
MDL number: MFCD00010724
EINECS: 677-580-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB150.40 | In Stock |
|
| 1G | RMB455.20 | In Stock |
|
| 5G | RMB1255.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 241-248°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystals or Powder |
| color | Purple to violet |
| Appearance | Purple to blue-purple crystals or powder |
| λmax | 417 nm 530 nm (2nd) |
| InChIKey | QBCIMRXPMLWVML-NHZJRHMYSA-N |
| SMILES | O(C1C=CC(C2=C3C=CC4C(C5C=CC(OC)=CC=5)=C5C=CC6=C(C7C=CC(OC)=CC=7)C7C=CC8=C(C9C=CC(OC)=CC=9)C9=CC=C2[N-]9[Co+2](N=78)([N-]56)N3=4)=CC=1)C |
Description and Uses
[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) is a versatile metalloporphyrin compound with significant potential in various applications. It is widely used in photodynamic therapy (PDT) for cancer treatment, where it can absorb light and produce reactive oxygen species to target and destroy cancer cells. Additionally, it plays a crucial role in the development of solar cells, enhancing the efficiency of light absorption and energy conversion in photovoltaic devices. The compound also serves as a catalyst in various chemical reactions, particularly in organic synthesis, improving reaction rates and selectivity compared to traditional catalysts. Furthermore, it is employed in the creation of sensors for detecting environmental pollutants, leveraging its ability to interact with specific molecules for accurate measurements. Its unique porphyrin structure makes it valuable in academic research for studying the properties of metal-organic frameworks and their potential applications in drug delivery and materials science.
Starting material in the synthesis of cobalt nitrosyl porphyrins for use in the study of the binding and activation of nitric oxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |

![[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II)](https://img.chemicalbook.com/CAS/GIF/28903-71-1.gif)


