A7981712
1,1,2,2-Tetrafluoroethyl 2,2,3,3-Tetrafluoropropyl Ether , 98% , 16627-68-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 100G | RMB825.60 | In Stock |
|
| 500g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 92 °C |
| Density | 1.533 |
| refractive index | 1.29 |
| Flash point: | 27.5 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.533 |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C5H4F8O/c6-2(7)4(10,11)1-14-5(12,13)3(8)9/h2-3H,1H2 |
| InChIKey | HCBRSIIGBBDDCD-UHFFFAOYSA-N |
| SMILES | C(F)(F)C(F)(F)COC(F)(F)C(F)F |
| CAS DataBase Reference | 16627-68-2(CAS DataBase Reference) |
| EPA Substance Registry System | (2H-Perfluoroethyl)(1H,1H,3H-perfluoropropyl)ether (16627-68-2) |
Description and Uses
1,1,2,2-Tetrafluoroethyl-2,2,3,3-tetrafluoropropyl ether (HFE-458) is a hydrofluoroether. Hydrofluoroether is a new type of chlorofluorocarbons (CFCs) substitute, ODP is zero, GWP is low, and the atmospheric residence time is very short. It is considered as one of the ideal substitutes for CFCs.
1,1,2,2-Tetrafluoroethyl-2,2,3,3-tetrafluoropropylether can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3271 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 29091990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |






