A7981812
4-(Trifluoromethoxy)toluene , >98.0%(GC) , 706-27-4
CAS NO.:706-27-4
Empirical Formula: C8H7F3O
Molecular Weight: 176.14
MDL number: MFCD00042413
EINECS: 211-895-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB162.40 | In Stock |
|
| 25g | RMB452.80 | In Stock |
|
| 100g | RMB1574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 134-135 °C(lit.) |
| Density | 1.179 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 87 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.179 |
| InChI | InChI=1S/C8H7F3O/c1-6-2-4-7(5-3-6)12-8(9,10)11/h2-5H,1H3 |
| InChIKey | JUXFXYQUXNXVAA-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 706-27-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29093090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





