A7985312
<i>trans</i>,<i>cis</i>-2,6-Nonadien-1-ol , >97.0%(GC) , 28069-72-9
CAS NO.:28069-72-9
Empirical Formula: C9H16O
Molecular Weight: 140.22
MDL number: MFCD00014055
EINECS: 248-816-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB541.60 | In Stock |
|
| 25ML | RMB2055.20 | In Stock |
|
| 100ML | RMB5759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 96-100 °C(lit.) |
| Density | 0.873 g/mL at 25 °C(lit.) |
| FEMA | 2780 | 2,6-NONADIEN-1-OL |
| refractive index | n |
| Flash point: | 203 °F |
| storage temp. | 0-6°C |
| form | clear liquid |
| pka | 14.41±0.10(Predicted) |
| color | White to yellow liquid |
| Odor | powerful, vegetable odor |
| biological source | synthetic |
| Odor Type | green |
| JECFA Number | 1184 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C9H16O/c1-2-3-4-5-6-7-8-9-10/h3-4,7-8,10H,2,5-6,9H2,1H3/b4-3-,8-7+ |
| InChIKey | AMXYRHBJZOVHOL-ODYTWBPASA-N |
| SMILES | [H]\C(CC)=C(/[H])CC\C([H])=C(/[H])CO |
| LogP | 2.71 |
| EPA Substance Registry System | 2,6-Nonadien-1-ol, (2E,6Z)- (28069-72-9) |
Description and Uses
Food additive/natural product.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P362+P364-P332+P313-P403+P235 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| Safety Statements | 26-36-38 |
| WGK Germany | 2 |
| RTECS | RA5394000 |
| TSCA | TSCA listed |
| HS Code | 29052990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Irrit. 2 |
| Toxicity | skn-gpg 100%/24H MOD FCTOD7 20,771,82 |







