A7988612
Tetrabutylammonium Tetraphenylborate , >98.0%(HPLC) , 15522-59-5
Synonym(s):
Tetraphenylboron tetrabutylammonium
CAS NO.：15522-59-5
Empirical Formula: C40H56BN
Molecular Weight: 561.69
MDL number: MFCD00011749
EINECS: 239-562-9
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB55.20 | In Stock |
|
| 1G | RMB77.60 | In Stock |
|
| 5G | RMB317.60 | In Stock |
|
| 25g | RMB1273.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-236 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in pyridine, acetone, water. |
| Sensitive | Hygroscopic |
| BRN | 3857215 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Hygroscopic. |
| InChIKey | ZHCCBGAUZWZGQV-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.c1ccc(cc1)[B-](c2ccccc2)(c3ccccc3)c4ccccc4 |
Description and Uses
Tetrabutylammonium tetraphenylborate (CAS# 15522-59-5) is an organic electrolyte, and an electrotunable compound, allowing for its use in the preparation of interesting materials such as electrotunable nanoplasmonic liquid mirrors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-9 |
| HS Code | 2923.90.0100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
