A7989712
Tetraphenylphosphonium Chloride , >98.0%(T) , 2001-45-8
CAS NO.：2001-45-8
Empirical Formula: C24H20ClP
Molecular Weight: 374.84
MDL number: MFCD00011916
EINECS: 217-890-3
| Pack Size | Price | Stock | Quantity |
| 2g | RMB17.60 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB31.20 | In Stock |
|
| 25G | RMB45.60 | In Stock |
|
| 100G | RMB141.60 | In Stock |
|
| 500G | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 272-274 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3922393 |
| InChI | InChI=1S/C24H20P.ClH/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H/q+1;/p-1 |
| InChIKey | WAGFXJQAIZNSEQ-UHFFFAOYSA-M |
| SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)C1=CC=CC=C1.[Cl-] |
| CAS DataBase Reference | 2001-45-8(CAS DataBase Reference) |
Description and Uses
Tetraphenylphosphonium chloride is used to generate lipophilic salts from inorganic and organometallic anions. Thus, Ph4P+ is useful as a phase-transfer catalyst, again because it allows inorganic anions to dissolve in organic solvents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29310095 |
