A7990512
4,4,5,5-Tetramethyl-2-(<i>m</i>-tolyl)-1,3,2-dioxaborolane , ≥98.0% , 253342-48-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB176.80 | In Stock |
|
| 25G | RMB695.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34.0 to 38.0 °C |
| Boiling point: | 307.2±21.0 °C(Predicted) |
| Density | 0.98±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Almost white |
| λmax | 273nm(CH3CN)(lit.) |
| InChI | 1S/C13H19BO2/c1-10-7-6-8-11(9-10)14-15-12(2,3)13(4,5)16-14/h6-9H,1-5H3 |
| InChIKey | XDKYCZBGHPGKEP-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C)(C)OB(C2=CC=CC(C)=C2)O1 |
| CAS DataBase Reference | 253342-48-2(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







