A8011612
Tetraallylsilane , 95.0%(GC) , 1112-66-9
Synonym(s):
Tetra(2-propenyl)silane
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB77.60 | In Stock |
|
| 5ML | RMB272.00 | In Stock |
|
| 25ml | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 90 °C/3 mmHg (lit.) |
| Density | 0.831 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 171 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| Specific Gravity | 0.8345 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 1750943 |
| InChI | InChI=1S/C12H20Si/c1-5-9-13(10-6-2,11-7-3)12-8-4/h5-8H,1-4,9-12H2 |
| InChIKey | AKRQMTFHUVDMIL-UHFFFAOYSA-N |
| SMILES | [Si](CC=C)(CC=C)(CC=C)CC=C |
| CAS DataBase Reference | 1112-66-9(CAS DataBase Reference) |
Description and Uses
It is used in synthesis of dendrimers and as an intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
