A8011912
2,4,5-<WBR>Trifluoro-<WBR>3-<WBR>methoxybenzoyl chloride , 97% , 112811-66-2
CAS NO.：112811-66-2
Empirical Formula: C8H4ClF3O2
Molecular Weight: 224.56
MDL number: MFCD02682012
EINECS: 629-469-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB119.20 | In Stock |
|
| 5G | RMB375.20 | In Stock |
|
| 25G | RMB1268.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 229.2±35.0 °C(Predicted) |
| Density | 1.472 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 126 °F |
| storage temp. | RT, stored under nitrogen |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C8H4ClF3O2/c1-14-7-5(11)3(8(9)13)2-4(10)6(7)12/h2H,1H3 |
| InChIKey | JVQSZTJTWSUJCR-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC(F)=C(F)C(OC)=C1F |
| CAS DataBase Reference | 112811-66-2(CAS DataBase Reference) |
Description and Uses
2,4,5-Trifluoro-3-methoxybenzoyl chloride was used as an intermediate of Moxifloxacin hydrochloride.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34-36/37/38-20/21/22-14-29 |
| Safety Statements | 26-36/37/39-45-24/25-23-8-30 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2918999090 |
