A8035212
3-<WBR>(Trifluoromethoxy)<WBR>benzenesulfonyl chloride , 97% , 220227-84-9
CAS NO.:220227-84-9
Empirical Formula: C7H4ClF3O3S
Molecular Weight: 260.62
MDL number: MFCD01091016
EINECS: 624-326-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB127.20 | In Stock |
|
| 1G | RMB144.80 | In Stock |
|
| 5g | RMB711.20 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-230℃ |
| Boiling point: | 229-230 °C(lit.) |
| Density | 1.530 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H4ClF3O3S/c8-15(12,13)6-3-1-2-5(4-6)14-7(9,10)11/h1-4H |
| InChIKey | DODDSXTWDSJCDN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1cccc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 220227-84-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H314 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2909309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







