A8041812
Tetrapropylammonium tetrafluoroborate , 98% , 338-38-5
CAS NO.：338-38-5
Empirical Formula: C12H28BF4N
Molecular Weight: 273.16
MDL number: MFCD00031619
EINECS: 206-416-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5g | RMB159.20 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-247 °C |
| Density | 1.115 g/cm3 |
| form | crystals |
| BRN | 3637590 |
| InChI | 1S/C12H28N.BF4/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3,4)5/h5-12H2,1-4H3;/q+1;-1 |
| InChIKey | ADADJCUTHQJPCB-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.CCC[N+](CCC)(CCC)CCC |
Description and Uses
Tetrapropylammonium tetrafluoroborate (Pr4NBF4 or TPABF4) can be used as:
- An electrolyte in the determination of phenolic compounds from grape seed extracts by capillary electrophoretic method.
- A supporting electrolyte in the electrochemical hydrogenation of dimethylformamide (DMF) to trimethylamine (TMA).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | BS8420000 |
| Hazard Note | Corrosive |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
