A8045212
1,2,3,4-<WBR>Tetramethyl-<WBR>1,3-<WBR>cyclopentadiene , Alien mixture, 85% , 4249-10-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB423.20 | In Stock |
|
| 5G | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 142 °C (lit.) |
| Density | 0.808 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 108 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Not miscible mix with mater. |
| form | Liquid |
| Specific Gravity | 0.808 |
| color | Light yellow |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/C9H14/c1-6-5-7(2)9(4)8(6)3/h5H2,1-4H3 |
| InChIKey | VNPQQEYMXYCAEZ-UHFFFAOYSA-N |
| SMILES | C1(C)CC(C)=C(C)C=1C |
Description and Uses
1,2,3,4-Tetramethylcyclopenta-1,3-diene is an intermediate in the conversion of ethylene to polyenes
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 3295 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29021900 |
