A8046612
1,2,4-<WBR>Triazole-<WBR>3-<WBR>carboxylic acid , 97% , 4928-87-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB187.92 | In Stock |
|
| 5g | RMB237.60 | In Stock |
|
| 10G | RMB479.20 | In Stock |
|
| 25g | RMB943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-136 °C |
| Boiling point: | 444.6±28.0 °C(Predicted) |
| Density | 1.694±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Sonicated), Methanol (Slightly, Heated, |
| form | Powder |
| pka | 10.78±0.20(Predicted) |
| color | White to pale brown |
| InChI | InChI=1S/C3H3N3O2/c7-3(8)2-4-1-5-6-2/h1H,(H,7,8)(H,4,5,6) |
| InChIKey | LJVQHXICFCZRJN-UHFFFAOYSA-N |
| SMILES | N1C(C(O)=O)=NC=N1 |
| CAS DataBase Reference | 4928-87-4(CAS DataBase Reference) |
Description and Uses
1,2,4-Triazole-3-carboxylic Acid (Ribavirin EP Impurity C) is a major metabolite of the antiviral agent Ribavirin (R414475).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
