A8247812
tert-Butyl 5-bromo-3,4-dihydroisoquinoline-2(1H)-carboxylate , 98% , 215184-78-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB67.20 | In Stock |
|
| 1G | RMB164.00 | In Stock |
|
| 5g | RMB513.60 | In Stock |
|
| 25g | RMB1654.40 | In Stock |
|
| 100g | RMB6399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 382.4±42.0 °C(Predicted) |
| Density | 1.353±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -1.56±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C14H18BrNO2/c1-14(2,3)18-13(17)16-8-7-11-10(9-16)5-4-6-12(11)15/h4-6H,7-9H2,1-3H3 |
| InChIKey | YSAAGRAKROVFRY-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(Br)=CC=C2)CCN1C(OC(C)(C)C)=O |
Description and Uses
5-Bromo-3,4-dihydro-1H-isoquinoline-2-carboxylic Acid tert-Butyl Ester is an intermediate used to prepare 4,1-benzoxazepines as somatostatin agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |







