A8255312
1,2,4-Tribromo-5-methylbenzene , 98% , 3278-88-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB27.20 | In Stock |
|
| 1G | RMB68.00 | In Stock |
|
| 5g | RMB224.00 | In Stock |
|
| 25g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114°C |
| Boiling point: | 299.3±35.0 °C(Predicted) |
| Density | 2.131±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Brown |
| InChI | InChI=1S/C7H5Br3/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,1H3 |
| InChIKey | KZZJNNUPNNBCCH-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=C(Br)C=C1Br |
| CAS DataBase Reference | 3278-88-4(CAS DataBase Reference) |
Description and Uses
2,4,5-Tribromotoluene can be used as a method for decompoising halogenated organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2902900000 |
