A8256712
Trimethyl[3-(trimethoxysilyl)propyl]ammonium Chloride (ca. 50% in Methanol) , 50%inMethanol , 35141-36-7
CAS NO.:35141-36-7
Empirical Formula: C9H24ClNO3Si
Molecular Weight: 257.83
MDL number: MFCD00054225
EINECS: 252-393-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB231.20 | In Stock |
|
| 100g | RMB711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 68°C |
| Density | 0.927 |
| refractive index | 1.3966 |
| Flash point: | 11°C |
| solubility | soluble in Chloroform, Methanol |
| form | clear liquid |
| Specific Gravity | 0.927 |
| color | Colorless to Light yellow |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Exposure limits | ACGIH: TWA 200 ppm; STEL 250 ppm (Skin) OSHA: TWA 200 ppm(260 mg/m3) NIOSH: IDLH 6000 ppm; TWA 200 ppm(260 mg/m3); STEL 250 ppm(325 mg/m3) |
| InChI | InChI=1S/C9H24NO3Si.ClH/c1-10(2,3)8-7-9-14(11-4,12-5)13-6;/h7-9H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | FYZFRYWTMMVDLR-UHFFFAOYSA-M |
| SMILES | [Si](OC)(OC)(OC)CCC[N+](C)(C)C.[Cl-] |
| CAS DataBase Reference | 35141-36-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanaminium, N,N,N-trimethyl-3-(trimethoxysilyl)-, chloride (35141-36-7) |
Description and Uses
Trimethyl[3-(trimethoxysilyl)propyl]ammonium (chloride) (50% in methanol) is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS07,GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H315-H319-H335-H370-H302-H311-H331 |
| Precautionary statements | P210-P260-P280-P301+P310-P305+P351+P338-P311-P303+P361+P353-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 11-23/24/25-36/37/38-20/21/22-51/53-39/23/24/25 |
| Safety Statements | 7-16-36/37/39-45-36-26-61-36/37 |
| RIDADR | 1992 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |

![Trimethyl[3-(trimethoxysilyl)propyl]ammonium Chloride (ca. 50% in Methanol)](https://img.chemicalbook.com/CAS/GIF/35141-36-7.gif)




