A8263412
Trisodium nitrilotriacetate , 98% , 5064-31-3
Synonym(s):
N,N-Bis(carboxymethyl)glycine;NTA;Triglycollamic acid
CAS NO.:5064-31-3
Empirical Formula: C6H10NNaO6
Molecular Weight: 215.14
MDL number: MFCD00064231
EINECS: 225-768-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB36.80 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 500g | RMB279.20 | In Stock |
|
| 2.5kg | RMB910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.77[at 20℃] |
| storage temp. | Storage temp. 2-8°C |
| pka | 1.22[at 20 ℃] |
| form | Solid |
| color | White to off-white |
| Water Solubility | 457g/L at 20℃ |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | InChI=1S/C6H9NO6.Na.H/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);; |
| InChIKey | NRPLCXWHMHCDFN-UHFFFAOYSA-N |
| SMILES | N(CC(=O)O)(CC(=O)O)CC(=O)O.[NaH] |
| LogP | -13.2 |
| CAS DataBase Reference | 5064-31-3(CAS DataBase Reference) |
| EPA Substance Registry System | Nitrilotriacetic acid trisodium salt (5064-31-3) |
Description and Uses
Nitrilotriacetic Acid Trisodium Salt is a sequestering agent that forms stable complexes with Zinc.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H319-H351 |
| Precautionary statements | P201-P301+P312+P330-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-40-36 |
| Safety Statements | 36-46-36/37-26 |
| WGK Germany | 2 |
| RTECS | MB8400000 |
| Hazardous Substances Data | 5064-31-3(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 1100mg/kg |




