A8322512
Undecafluorohexanoic acid , 98% , 307-24-4
Synonym(s):
Perfluorocaproic acid;Perfluorohexanoic acid
CAS NO.:307-24-4
Empirical Formula: C6HF11O2
Molecular Weight: 314.05
MDL number: MFCD00198040
EINECS: 206-196-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB45.60 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB288.80 | In Stock |
|
| 100g | RMB1000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 14 °C |
| Boiling point: | 157 °C |
| Density | 1.759 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | water: insoluble |
| pka | 0.42±0.10(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| Specific Gravity | 1.762 |
| Water Solubility | water: insoluble |
| BRN | 1805852 |
| Stability: | Stable, but may be light sensitive. Incompatible with oxidizing agents. |
| InChI | 1S/C6HF11O2/c7-2(8,1(18)19)3(9,10)4(11,12)5(13,14)6(15,16)17/h(H,18,19) |
| InChIKey | PXUULQAPEKKVAH-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 307-24-4(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorohexanoic acid (307-24-4) |
Description and Uses
Undecafluorohexanoic acid, a volatile ion-pair reagent, has been used as mobile phase for LC-MS analysis of highly polar sulfonium pseudo-sugar constituents neosalacinol and neokotalanol, potential α-glucosidase inhibitors isolated from ayurvedic traditional medicine Salacia species.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 3-8 |
| Hazard Note | Corrosive/Toxic |
| TSCA | TSCA listed |
| HazardClass | CORROSIVE |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 307-24-4(Hazardous Substances Data) |




