A8322612
10-Undecenoyl chloride , 98% , 38460-95-6
CAS NO.:38460-95-6
Empirical Formula: C11H19ClO
Molecular Weight: 202.72
MDL number: MFCD00000772
EINECS: 253-951-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB171.20 | In Stock |
|
| 100G | RMB460.00 | In Stock |
|
| 250G | RMB1255.20 | In Stock |
|
| 500G | RMB1400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-122 °C10 mm Hg(lit.) |
| Density | 0.944 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| color | Clear yellow |
| BRN | 1635112 |
| InChI | InChI=1S/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2 |
| InChIKey | MZFGYVZYLMNXGL-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCCCCCC=C |
| CAS DataBase Reference | 38460-95-6(CAS DataBase Reference) |
| EPA Substance Registry System | 10-Undecenoyl chloride (38460-95-6) |
Description and Uses
10-Undecenoyl chloride was used as acylating reagent in the synthesis of cellulose ω-carboxyalkanoates and poly(ethylene glycol)–lipid amphiphiles. It was used in synthesis and modification of hyperbranched poly(glycidol).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P280-P303+P361+P353-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | YQ2991000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29161910 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |





