A8324912
Uridine , 99% , 58-96-8
CAS NO.:58-96-8
Empirical Formula: C9H12N2O6
Molecular Weight: 244.2
MDL number: MFCD00006526
EINECS: 200-407-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB224.80 | In Stock |
|
| 500g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-167 °C(lit.) |
| alpha | 8.4 º (c=2,water) |
| Boiling point: | 387.12°C (rough estimate) |
| Density | 1.4221 (rough estimate) |
| refractive index | 9 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| pka | 9.39±0.10(Predicted) |
| color | White to almost white |
| PH | 9.05 |
| biological source | synthetic (organic) |
| Water Solubility | Soluble in water, dimethylsulfoxide, and methanol. |
| λmax | 262 (pH 7);262 (pH 12) |
| Merck | 14,9877 |
| BRN | 754904 |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChI | 1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | DRTQHJPVMGBUCF-XVFCMESISA-N |
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N2C=CC(=O)NC2=O |
| LogP | -1.581 (est) |
| CAS DataBase Reference | 58-96-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Uridine(58-96-8) |
| EPA Substance Registry System | Uridine (58-96-8) |
Description and Uses
Uridine is a nucleoside; widely distributed in nature. Uridine is one of the four basic components of ribonucleic acid (RNA)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | YR1450000 |
| F | 10 |
| Hazard Note | Keep Cold |
| TSCA | TSCA listed |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |





