PRODUCT Properties
| Melting point: | 244-246 °C |
| alpha | D -556° (chloroform) |
| Boiling point: | 386.03°C (rough estimate) |
| Density | 1.3358 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point: | -11 °C |
| storage temp. | 2-8°C |
| solubility | DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble |
| form | Solid |
| color | White to off-white |
| biological source | Aspergillus flavus |
| Water Solubility | 15mg/L(temperature not stated) |
| BRN | 1299768 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C17H12O7/c1-20-9-6-10-12(8-3-5-22-17(8)23-10)14-11(9)7-2-4-21-15(18)13(7)16(19)24-14/h3,5-6,8,17H,2,4H2,1H3 |
| InChIKey | XWIYFDMXXLINPU-UHFFFAOYSA-N |
| SMILES | COc1cc2OC3OC=CC3c2c4OC(=O)C5=C(CCOC5=O)c14 |
| LogP | 0.679 (est) |
| EPA Substance Registry System | Aflatoxin G1 (1165-39-5) |
Description and Uses
Aflatoxin G1 from Aspergillus flavus has been used as a standard for the determination of aflatoxin in various samples.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H319-H340-H350-H372-H412 |
| Precautionary statements | P210-P273-P301+P310-P303+P361+P353-P305+P351+P338-P331 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,F,Xn |
| Risk Statements | 45-26/27/28-65-48/23/24/25-36/38-11-46-39/23/24/25-23/24/25-36-20/21/22 |
| Safety Statements | 53-28-36/37-45-62-26-16-7-36 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | LV1720000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 1165-39-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in day old duckling: 39.2 mg/50 gm body wt (Carnaghan) |







