A8349412
                    Vanillylamine hydrochloride , 99% , 7149-10-2
                            Synonym(s):
4-Hydroxy-3-methoxybenzylamine hydrochloride;Vanillylamine hydrochloride
                            
                        
                CAS NO.:7149-10-2
Empirical Formula: C8H12ClNO2
Molecular Weight: 189.64
MDL number: MFCD00012864
EINECS: 230-468-3
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB31.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB68.00 | In Stock | 
                                                 | 
                                        
| 100g | RMB236.00 | In Stock | 
                                                 | 
                                        
| 500g | RMB1100.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 219-221 °C (dec.)(lit.) | 
                                    
| storage temp. | Store below +30°C. | 
                                    
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) | 
                                    
| form | Powder | 
                                    
| color | Off-white | 
                                    
| Sensitive | Moisture Sensitive | 
                                    
| BRN | 3915418 | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChI | InChI=1S/C8H11NO2.ClH/c1-11-8-4-6(5-9)2-3-7(8)10;/h2-4,10H,5,9H2,1H3;1H | 
                                    
| InChIKey | PUDMGOSXPCMUJZ-UHFFFAOYSA-N | 
                                    
| SMILES | C1(OC)=C(O)C=CC(CN)=C1.Cl | 
                                    
| LogP | 5.4 at 30℃ | 
                                    
| CAS DataBase Reference | 7149-10-2(CAS DataBase Reference) | 
                                    
Description and Uses
A metabolite of Capsaicin.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-37/39-36 | 
| WGK Germany | 3 | 
| HazardClass | IRRITANT | 
| HS Code | 29214990 | 




![6-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl3-hydroxy-2-phenylpropanoate](https://img.chemicalbook.com/CAS/GIF/17659-49-3.gif)
