A8353512
Vinpocetine , 99% , 42971-09-5
Synonym(s):
(3α,16α)-Eburnamenine-14-carboxylic acid ethyl ester;Eburnamenine-14-carboxylic acid ethyl ester
CAS NO.:42971-09-5
Empirical Formula: C22H26N2O2
Molecular Weight: 350.46
MDL number: MFCD00211233
EINECS: 256-028-0
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB23.20 | In Stock |
|
| 100MG | RMB31.20 | In Stock |
|
| 1g | RMB50.40 | In Stock |
|
| 5g | RMB151.20 | In Stock |
|
| 25g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-153 °C dec. |
| alpha | D20 +114° (c = 1 in pyridine) |
| Boiling point: | 484.44°C (rough estimate) |
| Density | 1.1260 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: 5 mg/mL |
| form | solid |
| pka | 7.87±0.60(Predicted) |
| color | white |
| optical activity | [α]/D 148.5±5.0°, c = 0.1 in chloroform |
| λmax | 315nm(EtOH)(lit.) |
| Merck | 14,9991 |
| Stability: | Photosensitive |
| InChI | 1S/C22H26N2O2/c1-3-22-11-7-12-23-13-10-16-15-8-5-6-9-17(15)24(19(16)20(22)23)18(14-22)21(25)26-4-2/h5-6,8-9,14,20H,3-4,7,10-13H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | DDNCQMVWWZOMLN-IRLDBZIGSA-N |
| SMILES | [H][C@]12N3CCC[C@@]1(CC)C=C(C(=O)OCC)n4c2c(CC3)c5ccccc45 |
| LogP | 5.137 (est) |
| NIST Chemistry Reference | Vinpocetine(42971-09-5) |
Description and Uses
Vinpocetine (42971-09-5) is a phosphodiesterase PDE1 inhibitor (IC50=21 μM).1?Also blocks voltage-gated Na+?channels, IC50=44.2 μM (potency similar to phenytoin), a mechanism which may contribute to its neuroprotective and anticonvulsant activity.2?It reduces inflammatory IL-1β and TNF-α expression in rat hippocampus.3?Displays beneficial effects in a rat model of cerebral ischemia-reperfusion injury.4?Vinpocetine exerts neuroprotective effects by suppressing microglial inflammation.5
A derivative of Vincamine with vasodilating activity. Vasodilator (cerebral).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | JW4792000 |
| HS Code | 29399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in mice, rats (mg/kg): 534, 503 orally; 240, 133.8 i.p.; 58.7, 42.6 i.v. (Pálosi, Szporny), also reported as 161.2 mg/kg i.p. in mice (Cholnoky, Dmk) |







