A8357412
L-Valine ethyl ester hydrochloride , 98% , 17609-47-1
CAS NO.：17609-47-1
Empirical Formula: C7H16ClNO2
Molecular Weight: 181.66
MDL number: MFCD00012511
EINECS: 241-580-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25G | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105 °C(lit.) |
| alpha | 7 º (c=2, H2O) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +6.7°, c = 2 in H2O |
| InChI | InChI=1/C7H15NO2.ClH/c1-4-10-7(9)6(8)5(2)3;/h5-6H,4,8H2,1-3H3;1H/t6-;/s3 |
| InChIKey | PQGVTLQEKCJXKF-RGMNGODLSA-N |
| SMILES | [C@H](N)(C(C)C)C(=O)OCC.Cl |&1:0,r| |
| CAS DataBase Reference | 17609-47-1(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H336 |
| Precautionary statements | P501-P261-P270-P271-P264-P301+P312+P330-P304+P340+P312-P403+P233-P405 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
