A8365232
(S)-1-Cyclopropylethylamine , 95% , 195604-39-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB806.40 | In Stock |
|
| 5G | RMB3024.00 | In Stock |
|
| 25G | RMB5392.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -68℃ |
| Boiling point: | 95°C |
| Density | 0.920 |
| Flash point: | 95°C |
| pka | 10.87±0.29(Predicted) |
| form | liquid |
| Water Solubility | Miscible with water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1/C5H11N/c1-4(6)5-2-3-5/h4-5H,2-3,6H2,1H3/t4-/s3 |
| InChIKey | IXCXVGWKYIDNOS-UFLUHPNLNA-N |
| SMILES | C1([C@H](C)N)CC1 |&1:1,r| |
| CAS DataBase Reference | 195604-39-8 |
Description and Uses
(S)-1-Cyclopropylethylamine acts as a chiral and organic building block in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314 |
| Precautionary statements | P210-P280-P305+P351+P338-P310 |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B |








