A8365912
1-Vinylnaphthalene , ≥95.0%(GC) , 826-74-4
CAS NO.：826-74-4
Empirical Formula: C12H10
Molecular Weight: 154.21
MDL number: MFCD00075766
EINECS: 212-560-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB271.20 | In Stock |
|
| 25g | RMB1108.00 | In Stock |
|
| 100g | RMB4199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 322 °C |
| Boiling point: | 135-138 °C (lit.) |
| Density | 1.04 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 101 °C |
| storage temp. | -20°C |
| solubility | Soluble in ethyl acetate, hexane and methanol. |
| form | Oil |
| color | Colourless to Orange |
| Sensitive | Moisture Sensitive |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI | InChI=1S/C12H10/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h2-9H,1H2 |
| InChIKey | IGGDKDTUCAWDAN-UHFFFAOYSA-N |
| SMILES | C1(C=C)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 826-74-4(CAS DataBase Reference) |
Description and Uses
1-Vinylnaphthalene is used as a precursor of polynuclear aromatic hydrocarbons in tobacco smoke. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H411 |
| Precautionary statements | P261-P264-P273-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-22 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 2 |
| HS Code | 29029090 |
