A8370612
Vinylferrocene , >97.0%(GC) , 1271-51-8
CAS NO.:1271-51-8
Empirical Formula: C12H12Fe10*
Molecular Weight: 212.07
MDL number: MFCD00001434
EINECS: 215-041-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB175.20 | In Stock |
|
| 1G | RMB204.80 | In Stock |
|
| 5g | RMB681.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-53 °C (lit.) |
| Boiling point: | 80-85 °C/0.2 mmHg (lit.) |
| Flash point: | 144 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | crystal |
| color | orange |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability: | Stable. Highly flammable. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C7H7.C5H5.Fe/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-5H; |
| InChIKey | LCPVTGDQYVLJHU-UHFFFAOYSA-N |
| SMILES | [C]1(C=C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,8,9,10,11| |
| NIST Chemistry Reference | Vinylferrocene(1271-51-8) |
Description and Uses
Used in the synthesis of 2-aminomethylferrocenes from vinyl ferrocene and lithium amides.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H228 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Statements | 11-22 |
| Safety Statements | 16-22-24/25-7/9-33 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | No |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





