A8382932
97% , 22112-83-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB239.20 | In Stock |
|
| 5g | RMB1790.40 | In Stock |
|
| 10g | RMB3439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C |
| Density | 1.319±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| Appearance | Purple to black Solid |
| InChIKey | NVCZKUSRWBBGAH-PJEPRTEXSA-N |
| SMILES | C1(C2C=CC(C(=O)OC)=CC=2)=C2C=CC(C(C3C=CC(C(=O)OC)=CC=3)=C3C=CC(=C(C4C=CC(C(=O)OC)=CC=4)C4C=CC(N=4)=C(C4C=CC(C(=O)OC)=CC=4)C4=CC=C1N4)N3)=N2 |c:11,31,49,t:27| |
Description and Uses
MESO-TETRA(4-CARBOXYPHENYL)PORPHINE TETRAMETHYL ESTER is used as an intermediate for the synthesis of MOF material ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |






