A8392132
Benzyltriethylammonium tetrafluoroborate , 95% , 77794-93-5
Synonym(s):
Benzyltriethylammonium tetrafluoroborate
CAS NO.：77794-93-5
Empirical Formula: C13H22BF4N
Molecular Weight: 279.13
MDL number: MFCD00011823
EINECS: 278-768-3
| Pack Size | Price | Stock | Quantity |
| 10G | RMB207.20 | In Stock |
|
| 50G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 °C |
| storage temp. | Store below +30°C. |
| form | crystals |
| Appearance | White to off-white Solid |
| Sensitive | Hygroscopic |
| BRN | 5198002 |
| InChI | 1S/C13H22N.BF4/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;2-1(3,4)5/h7-11H,4-6,12H2,1-3H3;/q+1;-1 |
| InChIKey | KJWXXJMAQURGGG-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.[N+](CC)(CC)(CC)Cc1ccccc1 |
| CAS DataBase Reference | 77794-93-5(CAS DataBase Reference) |
Description and Uses
Benzyltriethylammonium Tetrafluoroborate is used as a key intermediate in the preparation of quaternary ammonium-based ionic liquids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| Hazard Note | Irritant |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
