A8392332
97% , 78525-34-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB194.40 | In Stock |
|
| 1G | RMB600.00 | In Stock |
|
| 5g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 634.8±55.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.29±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C26H24N4/c27-21-9-1-17(2-10-21)25(18-3-11-22(28)12-4-18)26(19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20/h1-16H,27-30H2 |
| InChIKey | JGUVAGVIFMBVCK-UHFFFAOYSA-N |
| SMILES | C(/C1=CC=C(N)C=C1)(\C1=CC=C(N)C=C1)=C(\C1=CC=C(N)C=C1)/C1=CC=C(N)C=C1 |
Description and Uses
Tetrakis(4-aminophenyl)ethene belongs to hydrocarbon derivatives and can be used as pharmaceutical intermediates in medical experimental research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
